About 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine
3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine (PubChem CID 2830214) has the molecular formula C21H25N2S+
and a molecular weight of 337.51 g/mol. Its IUPAC name is 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine.
Molecular Properties
| Compound Name | 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine |
| PubChem CID | 2830214 |
| Molecular Formula | C21H25N2S+ |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine |
| SMILES | CCCCCC[n+]1c(-c2ccccc2)csc1Nc1ccccc1 |
| InChI | InChI=1S/C21H24N2S/c1-2-3-4-11-16-23-20(18-12-7-5-8-13-18)17-24-21(23)22-19-14-9-6-10-15-19/h5-10,12-15,17H,2-4,11,16H2,1H3/p+1 |
| InChIKey | XHCNCWPBQPUGMV-UHFFFAOYSA-O |
| XLogP | 6.03 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine?
The IUPAC name of 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine (CID 2830214) is 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine.
What is the SMILES notation for 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine?
The canonical SMILES for 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine is CCCCCC[n+]1c(-c2ccccc2)csc1Nc1ccccc1.
What is the InChIKey of 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine?
The InChIKey is XHCNCWPBQPUGMV-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H24N2S/c1-2-3-4-11-16-23-20(18-12-7-5-8-13-18)17-24-21(23)22-19-14-9-6-10-15-19/h5-10,12-15,17H,2-4,11,16H2,1H3/p+1.
What are the key properties of 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine?
3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine has a molecular weight of 337.51 g/mol, XLogP of 6.03, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-N,4-diphenyl-1,3-thiazol-3-ium-2-amine is sourced from PubChem (CID 2830214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).