C16H12N8O6 — CID 2830441
5-nitro-2-N,4-N-bis(4-nitrophenyl)pyrimidine-2,4,6-triamine (PubChem CID 2830441) has the molecular formula C16H12N8O6 and a molecular weight of 412.32 g/mol. Its IUPAC name is 5-nitro-2-N,4-N-bis(4-nitrophenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 5-nitro-2-N,4-N-bis(4-nitrophenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 2830441 |
| Molecular Formula | C16H12N8O6 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 5-nitro-2-N,4-N-bis(4-nitrophenyl)pyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(Nc2ccc([N+](=O)[O-])cc2)nc(Nc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N8O6/c17-14-13(24(29)30)15(18-9-1-5-11(6-2-9)22(25)26)21-16(20-14)19-10-3-7-12(8-4-10)23(27)28/h1-8H,(H4,17,18,19,20,21) |
| InChIKey | XROZFECVURUPJB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 205.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|