About 2-chloroanthracene
2-chloroanthracene (PubChem CID 28308) has the molecular formula C14H9Cl
and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-chloroanthracene.
Molecular Properties
| Compound Name | 2-chloroanthracene |
| PubChem CID | 28308 |
| Molecular Formula | C14H9Cl |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2-chloroanthracene |
| SMILES | Clc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H9Cl/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H |
| InChIKey | OWFINXQLBMJDJQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroanthracene?
The IUPAC name of 2-chloroanthracene (CID 28308) is 2-chloroanthracene.
What is the SMILES notation for 2-chloroanthracene?
The canonical SMILES for 2-chloroanthracene is Clc1ccc2cc3ccccc3cc2c1.
What is the InChIKey of 2-chloroanthracene?
The InChIKey is OWFINXQLBMJDJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H.
What are the key properties of 2-chloroanthracene?
2-chloroanthracene has a molecular weight of 212.68 g/mol, XLogP of 4.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroanthracene is sourced from PubChem (CID 28308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).