About 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride
3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride (PubChem CID 2830874) has the molecular formula C23H32ClNO3
and a molecular weight of 405.97 g/mol. Its IUPAC name is 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride.
Molecular Properties
| Compound Name | 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride |
| PubChem CID | 2830874 |
| Molecular Formula | C23H32ClNO3 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride |
| SMILES | CCOC(C(=O)OCCCN(CC)CC)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C23H31NO3.ClH/c1-4-24(5-2)18-13-19-26-22(25)23(27-6-3,20-14-9-7-10-15-20)21-16-11-8-12-17-21;/h7-12,14-17H,4-6,13,18-19H2,1-3H3;1H |
| InChIKey | ZEHHJPRMSKWOGK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
The IUPAC name of 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride (CID 2830874) is 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride.
What is the SMILES notation for 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
The canonical SMILES for 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride is CCOC(C(=O)OCCCN(CC)CC)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
The InChIKey is ZEHHJPRMSKWOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO3.ClH/c1-4-24(5-2)18-13-19-26-22(25)23(27-6-3,20-14-9-7-10-15-20)21-16-11-8-12-17-21;/h7-12,14-17H,4-6,13,18-19H2,1-3H3;1H.
What are the key properties of 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride?
3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride has a molecular weight of 405.97 g/mol, XLogP of 4.66, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)propyl 2-ethoxy-2,2-diphenylacetate;hydrochloride is sourced from PubChem (CID 2830874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).