About 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate
3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate (PubChem CID 2830877) has the molecular formula C25H37NO7S
and a molecular weight of 495.64 g/mol. Its IUPAC name is 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate.
Molecular Properties
| Compound Name | 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate |
| PubChem CID | 2830877 |
| Molecular Formula | C25H37NO7S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate |
| SMILES | CCOC(C(=O)OCCC[N+](C)(CC)CC)(c1ccccc1)c1ccccc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C24H34NO3.CH4O4S/c1-5-25(4,6-2)19-14-20-27-23(26)24(28-7-3,21-15-10-8-11-16-21)22-17-12-9-13-18-22;1-5-6(2,3)4/h8-13,15-18H,5-7,14,19-20H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | DCNAHKQFUHDDKP-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate?
The IUPAC name of 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate (CID 2830877) is 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate.
What is the SMILES notation for 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate?
The canonical SMILES for 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate is CCOC(C(=O)OCCC[N+](C)(CC)CC)(c1ccccc1)c1ccccc1.COS(=O)(=O)[O-].
What is the InChIKey of 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate?
The InChIKey is DCNAHKQFUHDDKP-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H34NO3.CH4O4S/c1-5-25(4,6-2)19-14-20-27-23(26)24(28-7-3,21-15-10-8-11-16-21)22-17-12-9-13-18-22;1-5-6(2,3)4/h8-13,15-18H,5-7,14,19-20H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate?
3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate has a molecular weight of 495.64 g/mol, XLogP of 3.48, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethoxy-2,2-diphenylacetyl)oxypropyl-diethyl-methylazanium;methyl sulfate is sourced from PubChem (CID 2830877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).