About 2,7-dimethoxyxanthen-9-one
2,7-dimethoxyxanthen-9-one (PubChem CID 2831136) has the molecular formula C15H12O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 2,7-dimethoxyxanthen-9-one.
Molecular Properties
| Compound Name | 2,7-dimethoxyxanthen-9-one |
| PubChem CID | 2831136 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2,7-dimethoxyxanthen-9-one |
| SMILES | COc1ccc2oc3ccc(OC)cc3c(=O)c2c1 |
| InChI | InChI=1S/C15H12O4/c1-17-9-3-5-13-11(7-9)15(16)12-8-10(18-2)4-6-14(12)19-13/h3-8H,1-2H3 |
| InChIKey | BWWOQQFGIMERAZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethoxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethoxyxanthen-9-one?
The IUPAC name of 2,7-dimethoxyxanthen-9-one (CID 2831136) is 2,7-dimethoxyxanthen-9-one.
What is the SMILES notation for 2,7-dimethoxyxanthen-9-one?
The canonical SMILES for 2,7-dimethoxyxanthen-9-one is COc1ccc2oc3ccc(OC)cc3c(=O)c2c1.
What is the InChIKey of 2,7-dimethoxyxanthen-9-one?
The InChIKey is BWWOQQFGIMERAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O4/c1-17-9-3-5-13-11(7-9)15(16)12-8-10(18-2)4-6-14(12)19-13/h3-8H,1-2H3.
What are the key properties of 2,7-dimethoxyxanthen-9-one?
2,7-dimethoxyxanthen-9-one has a molecular weight of 256.26 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethoxyxanthen-9-one is sourced from PubChem (CID 2831136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).