About propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate
propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (PubChem CID 2831153) has the molecular formula C8H15NO2S3
and a molecular weight of 253.41 g/mol. Its IUPAC name is propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
Molecular Properties
| Compound Name | propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| PubChem CID | 2831153 |
| Molecular Formula | C8H15NO2S3 |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| SMILES | CCCSC(=S)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO2S3/c1-2-4-13-8(12)9-7-3-5-14(10,11)6-7/h7H,2-6H2,1H3,(H,9,12) |
| InChIKey | JJBRKDPOXLAAGG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The IUPAC name of propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (CID 2831153) is propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
What is the SMILES notation for propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The canonical SMILES for propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate is CCCSC(=S)NC1CCS(=O)(=O)C1.
What is the InChIKey of propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The InChIKey is JJBRKDPOXLAAGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S3/c1-2-4-13-8(12)9-7-3-5-14(10,11)6-7/h7H,2-6H2,1H3,(H,9,12).
What are the key properties of propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate has a molecular weight of 253.41 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-(1,1-dioxothiolan-3-yl)carbamodithioate is sourced from PubChem (CID 2831153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).