About 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea
1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea (PubChem CID 2831176) has the molecular formula C10H13N3O3S
and a molecular weight of 255.30 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea |
| PubChem CID | 2831176 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea |
| SMILES | O=C(Nc1ccccn1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13N3O3S/c14-10(13-9-3-1-2-5-11-9)12-8-4-6-17(15,16)7-8/h1-3,5,8H,4,6-7H2,(H2,11,12,13,14) |
| InChIKey | DSBNLODKIMNNJR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea (CID 2831176) is 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea is O=C(Nc1ccccn1)NC1CCS(=O)(=O)C1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea?
The InChIKey is DSBNLODKIMNNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3S/c14-10(13-9-3-1-2-5-11-9)12-8-4-6-17(15,16)7-8/h1-3,5,8H,4,6-7H2,(H2,11,12,13,14).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea?
1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea has a molecular weight of 255.30 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-3-pyridin-2-ylurea is sourced from PubChem (CID 2831176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).