About 1,3-bis(1,1-dioxothiolan-3-yl)thiourea
1,3-bis(1,1-dioxothiolan-3-yl)thiourea (PubChem CID 2831203) has the molecular formula C9H16N2O4S3
and a molecular weight of 312.44 g/mol. Its IUPAC name is 1,3-bis(1,1-dioxothiolan-3-yl)thiourea.
Molecular Properties
| Compound Name | 1,3-bis(1,1-dioxothiolan-3-yl)thiourea |
| PubChem CID | 2831203 |
| Molecular Formula | C9H16N2O4S3 |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 1,3-bis(1,1-dioxothiolan-3-yl)thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)NC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C9H16N2O4S3/c12-17(13)3-1-7(5-17)10-9(16)11-8-2-4-18(14,15)6-8/h7-8H,1-6H2,(H2,10,11,16) |
| InChIKey | XEFICVPSYOOJMW-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(1,1-dioxothiolan-3-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1,1-dioxothiolan-3-yl)thiourea?
The IUPAC name of 1,3-bis(1,1-dioxothiolan-3-yl)thiourea (CID 2831203) is 1,3-bis(1,1-dioxothiolan-3-yl)thiourea.
What is the SMILES notation for 1,3-bis(1,1-dioxothiolan-3-yl)thiourea?
The canonical SMILES for 1,3-bis(1,1-dioxothiolan-3-yl)thiourea is O=S1(=O)CCC(NC(=S)NC2CCS(=O)(=O)C2)C1.
What is the InChIKey of 1,3-bis(1,1-dioxothiolan-3-yl)thiourea?
The InChIKey is XEFICVPSYOOJMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O4S3/c12-17(13)3-1-7(5-17)10-9(16)11-8-2-4-18(14,15)6-8/h7-8H,1-6H2,(H2,10,11,16).
What are the key properties of 1,3-bis(1,1-dioxothiolan-3-yl)thiourea?
1,3-bis(1,1-dioxothiolan-3-yl)thiourea has a molecular weight of 312.44 g/mol, XLogP of -1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1,1-dioxothiolan-3-yl)thiourea is sourced from PubChem (CID 2831203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).