About 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea
3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea (PubChem CID 2831206) has the molecular formula C7H14N2O2S2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea.
Molecular Properties
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea |
| PubChem CID | 2831206 |
| Molecular Formula | C7H14N2O2S2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H14N2O2S2/c1-9(2)7(12)8-6-3-4-13(10,11)5-6/h6H,3-5H2,1-2H3,(H,8,12) |
| InChIKey | VCDYQSSSPKUFNE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea?
The IUPAC name of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea (CID 2831206) is 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea.
What is the SMILES notation for 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea?
The canonical SMILES for 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea is CN(C)C(=S)NC1CCS(=O)(=O)C1.
What is the InChIKey of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea?
The InChIKey is VCDYQSSSPKUFNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2S2/c1-9(2)7(12)8-6-3-4-13(10,11)5-6/h6H,3-5H2,1-2H3,(H,8,12).
What are the key properties of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea?
3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea has a molecular weight of 222.33 g/mol, XLogP of -0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylthiourea is sourced from PubChem (CID 2831206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).