About 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol
3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol (PubChem CID 2831231) has the molecular formula C13H11NO3
and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol.
Molecular Properties
| Compound Name | 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol |
| PubChem CID | 2831231 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol |
| SMILES | OC1(c2ccccn2)COc2ccccc2O1 |
| InChI | InChI=1S/C13H11NO3/c15-13(12-7-3-4-8-14-12)9-16-10-5-1-2-6-11(10)17-13/h1-8,15H,9H2 |
| InChIKey | UQBAZSZCNIKUNS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol?
The IUPAC name of 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol (CID 2831231) is 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol.
What is the SMILES notation for 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol?
The canonical SMILES for 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol is OC1(c2ccccn2)COc2ccccc2O1.
What is the InChIKey of 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol?
The InChIKey is UQBAZSZCNIKUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c15-13(12-7-3-4-8-14-12)9-16-10-5-1-2-6-11(10)17-13/h1-8,15H,9H2.
What are the key properties of 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol?
3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol has a molecular weight of 229.24 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-yl-2H-1,4-benzodioxin-3-ol is sourced from PubChem (CID 2831231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).