About 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide
2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide (PubChem CID 2831368) has the molecular formula C14H19Cl3N2O
and a molecular weight of 337.68 g/mol. Its IUPAC name is 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide |
| PubChem CID | 2831368 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide |
| SMILES | CCN(CC)C(NC(=O)Cc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3N2O/c1-3-19(4-2)13(14(15,16)17)18-12(20)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3,(H,18,20) |
| InChIKey | OYAHPORANZJTRS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide?
The IUPAC name of 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide (CID 2831368) is 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide.
What is the SMILES notation for 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide?
The canonical SMILES for 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide is CCN(CC)C(NC(=O)Cc1ccccc1)C(Cl)(Cl)Cl.
What is the InChIKey of 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide?
The InChIKey is OYAHPORANZJTRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl3N2O/c1-3-19(4-2)13(14(15,16)17)18-12(20)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3,(H,18,20).
What are the key properties of 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide?
2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide has a molecular weight of 337.68 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N-[2,2,2-trichloro-1-(diethylamino)ethyl]acetamide is sourced from PubChem (CID 2831368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).