C38H28N2O6 — CID 2831523
2,6-bis[4-(3,4-dimethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 2831523) has the molecular formula C38H28N2O6 and a molecular weight of 608.65 g/mol. Its IUPAC name is 2,6-bis[4-(3,4-dimethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[4-(3,4-dimethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 2831523 |
| Molecular Formula | C38H28N2O6 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 2,6-bis[4-(3,4-dimethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(Oc2ccc(-n3c(=O)c4cc5c(=O)n(-c6ccc(Oc7ccc(C)c(C)c7)cc6)c(=O)c5cc4c3=O)cc2)cc1C |
| InChI | InChI=1S/C38H28N2O6/c1-21-5-11-29(17-23(21)3)45-27-13-7-25(8-14-27)39-35(41)31-19-33-34(20-32(31)36(39)42)38(44)40(37(33)43)26-9-15-28(16-10-26)46-30-12-6-22(2)24(4)18-30/h5-20H,1-4H3 |
| InChIKey | FDJJLUDQEYLVOE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |