C33H22N4O7 — CID 2831561
N-[4-[5-[2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]phenyl]acetamide (PubChem CID 2831561) has the molecular formula C33H22N4O7 and a molecular weight of 586.56 g/mol. Its IUPAC name is N-[4-[5-[2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[5-[2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 2831561 |
| Molecular Formula | C33H22N4O7 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | N-[4-[5-[2-(4-acetamidophenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4ccc(NC(C)=O)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C33H22N4O7/c1-17(38)34-21-5-9-23(10-6-21)36-30(41)25-13-3-19(15-27(25)32(36)43)29(40)20-4-14-26-28(16-20)33(44)37(31(26)42)24-11-7-22(8-12-24)35-18(2)39/h3-16H,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | VHMZROUQAKVBFA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|