C16H21ClN2O2S — CID 2831581
2-(dimethylamino)ethyl 1,3,4,5-tetrahydrothiopyrano[4,3-b]indole-8-carboxylate;hydrochloride (PubChem CID 2831581) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 1,3,4,5-tetrahydrothiopyrano[4,3-b]indole-8-carboxylate;hydrochloride.
| Compound Name | 2-(dimethylamino)ethyl 1,3,4,5-tetrahydrothiopyrano[4,3-b]indole-8-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 2831581 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(dimethylamino)ethyl 1,3,4,5-tetrahydrothiopyrano[4,3-b]indole-8-carboxylate;hydrochloride |
| SMILES | CN(C)CCOC(=O)c1ccc2[nH]c3c(c2c1)CSCC3.Cl |
| InChI | InChI=1S/C16H20N2O2S.ClH/c1-18(2)6-7-20-16(19)11-3-4-14-12(9-11)13-10-21-8-5-15(13)17-14;/h3-4,9,17H,5-8,10H2,1-2H3;1H |
| InChIKey | KLKCRNLMEUQBDE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|