About 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one
3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one (PubChem CID 2831697) has the molecular formula C13H12F3N3O3
and a molecular weight of 315.25 g/mol. Its IUPAC name is 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one |
| PubChem CID | 2831697 |
| Molecular Formula | C13H12F3N3O3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one |
| SMILES | CC1=C([N+](=O)[O-])C(c2ccccc2C(F)(F)F)NC(=O)N1C |
| InChI | InChI=1S/C13H12F3N3O3/c1-7-11(19(21)22)10(17-12(20)18(7)2)8-5-3-4-6-9(8)13(14,15)16/h3-6,10H,1-2H3,(H,17,20) |
| InChIKey | UEABLMDXZTYDMA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one?
The IUPAC name of 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one (CID 2831697) is 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one is CC1=C([N+](=O)[O-])C(c2ccccc2C(F)(F)F)NC(=O)N1C.
What is the InChIKey of 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one?
The InChIKey is UEABLMDXZTYDMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3O3/c1-7-11(19(21)22)10(17-12(20)18(7)2)8-5-3-4-6-9(8)13(14,15)16/h3-6,10H,1-2H3,(H,17,20).
What are the key properties of 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one?
3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one has a molecular weight of 315.25 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-nitro-6-[2-(trifluoromethyl)phenyl]-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 2831697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).