About diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate
diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate (PubChem CID 2831750) has the molecular formula C26H29NO4
and a molecular weight of 419.52 g/mol. Its IUPAC name is diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate |
| PubChem CID | 2831750 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccc(C)cc2)C=C(C)C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C26H29NO4/c1-5-30-25(28)22-18(4)16-21(27-20-14-12-17(3)13-15-20)24(26(29)31-6-2)23(22)19-10-8-7-9-11-19/h7-16,22-23,27H,5-6H2,1-4H3 |
| InChIKey | UJADVRXWVUZLCB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate?
The IUPAC name of diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate (CID 2831750) is diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate.
What is the SMILES notation for diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate?
The canonical SMILES for diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate is CCOC(=O)C1=C(Nc2ccc(C)cc2)C=C(C)C(C(=O)OCC)C1c1ccccc1.
What is the InChIKey of diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate?
The InChIKey is UJADVRXWVUZLCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29NO4/c1-5-30-25(28)22-18(4)16-21(27-20-14-12-17(3)13-15-20)24(26(29)31-6-2)23(22)19-10-8-7-9-11-19/h7-16,22-23,27H,5-6H2,1-4H3.
What are the key properties of diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate?
diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate has a molecular weight of 419.52 g/mol, XLogP of 5.15, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 6-methyl-4-(4-methylanilino)-2-phenylcyclohexa-3,5-diene-1,3-dicarboxylate is sourced from PubChem (CID 2831750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).