C16H19N3O4 — CID 2831775
1-methyl-2,3,4,5-tetrahydroazepino[2,3-b]quinolin-6-amine;oxalic acid (PubChem CID 2831775) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-methyl-2,3,4,5-tetrahydroazepino[2,3-b]quinolin-6-amine;oxalic acid.
| Compound Name | 1-methyl-2,3,4,5-tetrahydroazepino[2,3-b]quinolin-6-amine;oxalic acid |
|---|---|
| PubChem CID | 2831775 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-methyl-2,3,4,5-tetrahydroazepino[2,3-b]quinolin-6-amine;oxalic acid |
| SMILES | CN1CCCCc2c1nc1ccccc1c2N.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H17N3.C2H2O4/c1-17-9-5-4-7-11-13(15)10-6-2-3-8-12(10)16-14(11)17;3-1(4)2(5)6/h2-3,6,8H,4-5,7,9H2,1H3,(H2,15,16);(H,3,4)(H,5,6) |
| InChIKey | NIJNXGODIJJMBQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|