About N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide
N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide (PubChem CID 2832039) has the molecular formula C23H13Cl2I2NO3
and a molecular weight of 676.08 g/mol. Its IUPAC name is N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide.
Molecular Properties
| Compound Name | N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide |
| PubChem CID | 2832039 |
| Molecular Formula | C23H13Cl2I2NO3 |
| Molecular Weight | 676.08 g/mol |
| Exact Mass | 674.84 |
| IUPAC Name | N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Oc1ccc(Cl)c2ccccc12)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C23H13Cl2I2NO3/c24-12-5-7-21(31-20-8-6-17(25)14-3-1-2-4-15(14)20)19(9-12)28-23(30)16-10-13(26)11-18(27)22(16)29/h1-11,29H,(H,28,30) |
| InChIKey | PTIXJNCZRFOXHN-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 676.08 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide?
The IUPAC name of N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide (CID 2832039) is N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide.
What is the SMILES notation for N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide?
The canonical SMILES for N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide is O=C(Nc1cc(Cl)ccc1Oc1ccc(Cl)c2ccccc12)c1cc(I)cc(I)c1O.
What is the InChIKey of N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide?
The InChIKey is PTIXJNCZRFOXHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13Cl2I2NO3/c24-12-5-7-21(31-20-8-6-17(25)14-3-1-2-4-15(14)20)19(9-12)28-23(30)16-10-13(26)11-18(27)22(16)29/h1-11,29H,(H,28,30).
What are the key properties of N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide?
N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide has a molecular weight of 676.08 g/mol, XLogP of 8.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-chloro-2-(4-chloronaphthalen-1-yl)oxyphenyl]-2-hydroxy-3,5-diiodobenzamide is sourced from PubChem (CID 2832039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).