C11H17N — CID 2832191
2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine (PubChem CID 2832191) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 2832191 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine |
| SMILES | C=CCC1C=CCC(CC=C)N1 |
| InChI | InChI=1S/C11H17N/c1-3-6-10-8-5-9-11(12-10)7-4-2/h3-5,8,10-12H,1-2,6-7,9H2 |
| InChIKey | GAYQJEALDMVJON-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|