About 2-acetamidoacetamide
2-acetamidoacetamide (PubChem CID 28326) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is 2-acetamidoacetamide.
Molecular Properties
| Compound Name | 2-acetamidoacetamide |
| PubChem CID | 28326 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 2-acetamidoacetamide |
| SMILES | CC(=O)NCC(N)=O |
| InChI | InChI=1S/C4H8N2O2/c1-3(7)6-2-4(5)8/h2H2,1H3,(H2,5,8)(H,6,7) |
| InChIKey | WQELDIQOHGAHEM-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetamidoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoacetamide?
The IUPAC name of 2-acetamidoacetamide (CID 28326) is 2-acetamidoacetamide.
What is the SMILES notation for 2-acetamidoacetamide?
The canonical SMILES for 2-acetamidoacetamide is CC(=O)NCC(N)=O.
What is the InChIKey of 2-acetamidoacetamide?
The InChIKey is WQELDIQOHGAHEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2/c1-3(7)6-2-4(5)8/h2H2,1H3,(H2,5,8)(H,6,7).
What are the key properties of 2-acetamidoacetamide?
2-acetamidoacetamide has a molecular weight of 116.12 g/mol, XLogP of -1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoacetamide is sourced from PubChem (CID 28326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).