C13H22O2 — CID 2832770
2-Methyl-4-(tetrahydro-2,6,6-trimethyl-2H-pyran-2-yl)-3-butyn-2-ol (PubChem CID 2832770) has the molecular formula C13H22O2 and a molecular weight of 210.31 g/mol. Its IUPAC name is 2-methyl-4-(2,6,6-trimethyloxan-2-yl)but-3-yn-2-ol.
| Compound Name | 2-Methyl-4-(tetrahydro-2,6,6-trimethyl-2H-pyran-2-yl)-3-butyn-2-ol |
|---|---|
| PubChem CID | 2832770 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-methyl-4-(2,6,6-trimethyloxan-2-yl)but-3-yn-2-ol |
| SMILES | CC1(CCCC(O1)(C)C#CC(C)(C)O)C |
| InChI | InChI=1S/C13H22O2/c1-11(2,14)9-10-13(5)8-6-7-12(3,4)15-13/h14H,6-8H2,1-5H3 |
| InChIKey | YPIOECZVNPAIKU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 303 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|