About 6,10-dimethylundec-9-en-4-yne-3,6-diol
6,10-dimethylundec-9-en-4-yne-3,6-diol (PubChem CID 2832771) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 6,10-dimethylundec-9-en-4-yne-3,6-diol.
Molecular Properties
| Compound Name | 6,10-dimethylundec-9-en-4-yne-3,6-diol |
| PubChem CID | 2832771 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 6,10-dimethylundec-9-en-4-yne-3,6-diol |
| SMILES | CCC(O)C#CC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C13H22O2/c1-5-12(14)8-10-13(4,15)9-6-7-11(2)3/h7,12,14-15H,5-6,9H2,1-4H3 |
| InChIKey | MFUMAMONCVKBLU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,10-dimethylundec-9-en-4-yne-3,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dimethylundec-9-en-4-yne-3,6-diol?
The IUPAC name of 6,10-dimethylundec-9-en-4-yne-3,6-diol (CID 2832771) is 6,10-dimethylundec-9-en-4-yne-3,6-diol.
What is the SMILES notation for 6,10-dimethylundec-9-en-4-yne-3,6-diol?
The canonical SMILES for 6,10-dimethylundec-9-en-4-yne-3,6-diol is CCC(O)C#CC(C)(O)CCC=C(C)C.
What is the InChIKey of 6,10-dimethylundec-9-en-4-yne-3,6-diol?
The InChIKey is MFUMAMONCVKBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-12(14)8-10-13(4,15)9-6-7-11(2)3/h7,12,14-15H,5-6,9H2,1-4H3.
What are the key properties of 6,10-dimethylundec-9-en-4-yne-3,6-diol?
6,10-dimethylundec-9-en-4-yne-3,6-diol has a molecular weight of 210.32 g/mol, XLogP of 2.26, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dimethylundec-9-en-4-yne-3,6-diol is sourced from PubChem (CID 2832771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).