C22H37NO2 — CID 2832848
1-[[2-(3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1,3-dioxolan-4-yl]methyl]piperidine (PubChem CID 2832848) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 1-[[2-(3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1,3-dioxolan-4-yl]methyl]piperidine.
| Compound Name | 1-[[2-(3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1,3-dioxolan-4-yl]methyl]piperidine |
|---|---|
| PubChem CID | 2832848 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 1-[[2-(3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)-1,3-dioxolan-4-yl]methyl]piperidine |
| SMILES | CC1CC2=C(CC1C1OCC(CN3CCCCC3)O1)C(C)(C)CCC2 |
| InChI | InChI=1S/C22H37NO2/c1-16-12-17-8-7-9-22(2,3)20(17)13-19(16)21-24-15-18(25-21)14-23-10-5-4-6-11-23/h16,18-19,21H,4-15H2,1-3H3 |
| InChIKey | GWNYATQURCVOGA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|