About 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one
5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one (PubChem CID 2832865) has the molecular formula C13H13Cl3N2O
and a molecular weight of 319.62 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one |
| PubChem CID | 2832865 |
| Molecular Formula | C13H13Cl3N2O |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one |
| SMILES | CC(C)(C)C1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C13H13Cl3N2O/c1-13(2,3)10-6-11(19)18(17-10)12-8(15)4-7(14)5-9(12)16/h4-5H,6H2,1-3H3 |
| InChIKey | XKIYIQZAQZTYDI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one?
The IUPAC name of 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one (CID 2832865) is 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one.
What is the SMILES notation for 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one?
The canonical SMILES for 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one is CC(C)(C)C1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1.
What is the InChIKey of 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one?
The InChIKey is XKIYIQZAQZTYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl3N2O/c1-13(2,3)10-6-11(19)18(17-10)12-8(15)4-7(14)5-9(12)16/h4-5H,6H2,1-3H3.
What are the key properties of 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one?
5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one has a molecular weight of 319.62 g/mol, XLogP of 4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one is sourced from PubChem (CID 2832865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).