C15H12F4O2S — CID 2832878
4,4,5,5-tetrafluoro-3-hydroxy-3-phenyl-1-thiophen-2-ylpentan-1-one (PubChem CID 2832878) has the molecular formula C15H12F4O2S and a molecular weight of 332.32 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-3-hydroxy-3-phenyl-1-thiophen-2-ylpentan-1-one.
| Compound Name | 4,4,5,5-tetrafluoro-3-hydroxy-3-phenyl-1-thiophen-2-ylpentan-1-one |
|---|---|
| PubChem CID | 2832878 |
| Molecular Formula | C15H12F4O2S |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4,4,5,5-tetrafluoro-3-hydroxy-3-phenyl-1-thiophen-2-ylpentan-1-one |
| SMILES | O=C(CC(O)(c1ccccc1)C(F)(F)C(F)F)c1cccs1 |
| InChI | InChI=1S/C15H12F4O2S/c16-13(17)15(18,19)14(21,10-5-2-1-3-6-10)9-11(20)12-7-4-8-22-12/h1-8,13,21H,9H2 |
| InChIKey | NQEQEWWIEDXSKV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|