C13H21N5O2 — CID 28329
View drug profile → etamiphylline7-[2-(diethylamino)ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 28329) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 7-[2-(diethylamino)ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-(diethylamino)ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 28329 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 7-[2-(diethylamino)ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCN(CC)CCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H21N5O2/c1-5-17(6-2)7-8-18-9-14-11-10(18)12(19)16(4)13(20)15(11)3/h9H,5-8H2,1-4H3 |
| InChIKey | AWKLBIOQCIORSB-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |