C21H21FN8 — CID 2833185
6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 2833185) has the molecular formula C21H21FN8 and a molecular weight of 404.45 g/mol. Its IUPAC name is 6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 2833185 |
| Molecular Formula | C21H21FN8 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 6-N-(4-fluorophenyl)-2-N,2-N-dimethyl-4-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1[nH]c2ccccc2c1C=NNc1nc(Nc2ccc(F)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C21H21FN8/c1-13-17(16-6-4-5-7-18(16)24-13)12-23-29-20-26-19(27-21(28-20)30(2)3)25-15-10-8-14(22)9-11-15/h4-12,24H,1-3H3,(H2,25,26,27,28,29) |
| InChIKey | CMWBEJXPLWZTNT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|