C22H21N5O2 — CID 2833192
N-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-2-(3-methylanilino)acetamide (PubChem CID 2833192) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-2-(3-methylanilino)acetamide.
| Compound Name | N-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-2-(3-methylanilino)acetamide |
|---|---|
| PubChem CID | 2833192 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[(2-hydroxy-5-phenyldiazenylphenyl)methylideneamino]-2-(3-methylanilino)acetamide |
| SMILES | Cc1cccc(NCC(=O)NN=Cc2cc(/N=N/c3ccccc3)ccc2O)c1 |
| InChI | InChI=1S/C22H21N5O2/c1-16-6-5-9-19(12-16)23-15-22(29)27-24-14-17-13-20(10-11-21(17)28)26-25-18-7-3-2-4-8-18/h2-14,23,28H,15H2,1H3,(H,27,29)/b24-14?,26-25+ |
| InChIKey | HQCMLPXRQOOLMD-LXQIQQIKSA-N |
| XLogP | 4.68 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|