About 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide
3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 2833340) has the molecular formula C23H21BrN2OS
and a molecular weight of 453.41 g/mol. Its IUPAC name is 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide.
Molecular Properties
| Compound Name | 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide |
| PubChem CID | 2833340 |
| Molecular Formula | C23H21BrN2OS |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | COc1ccc(-c2csc(Nc3ccccc3)[n+]2Cc2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C23H20N2OS.BrH/c1-26-21-14-12-19(13-15-21)22-17-27-23(24-20-10-6-3-7-11-20)25(22)16-18-8-4-2-5-9-18;/h2-15,17H,16H2,1H3;1H |
| InChIKey | RZGXFVYNHXHFMT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 25.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The IUPAC name of 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide (CID 2833340) is 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide.
What is the SMILES notation for 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The canonical SMILES for 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide is COc1ccc(-c2csc(Nc3ccccc3)[n+]2Cc2ccccc2)cc1.[Br-].
What is the InChIKey of 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The InChIKey is RZGXFVYNHXHFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2OS.BrH/c1-26-21-14-12-19(13-15-21)22-17-27-23(24-20-10-6-3-7-11-20)25(22)16-18-8-4-2-5-9-18;/h2-15,17H,16H2,1H3;1H.
What are the key properties of 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide?
3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide has a molecular weight of 453.41 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine bromide is sourced from PubChem (CID 2833340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).