C11H12N4O2 — CID 2833366
3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2,9-diene-5,12-dione (PubChem CID 2833366) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2,9-diene-5,12-dione.
| Compound Name | 3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2,9-diene-5,12-dione |
|---|---|
| PubChem CID | 2833366 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2,9-diene-5,12-dione |
| SMILES | O=C1NN=C2C3CC(CC12)C1=NNC(=O)C1C3 |
| InChI | InChI=1S/C11H12N4O2/c16-10-6-2-4-1-5(9(6)13-14-10)3-7-8(4)12-15-11(7)17/h4-7H,1-3H2,(H,14,16)(H,15,17) |
| InChIKey | JCXUOPSZOYPQOC-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |