About [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate
[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate (PubChem CID 2833590) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate.
Molecular Properties
| Compound Name | [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate |
| PubChem CID | 2833590 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate |
| SMILES | Cc1cccc(N2C(=O)CC(S/C(N)=N/c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C18H17N3O2S/c1-12-6-5-9-14(10-12)21-16(22)11-15(17(21)23)24-18(19)20-13-7-3-2-4-8-13/h2-10,15H,11H2,1H3,(H2,19,20) |
| InChIKey | ZEJNZKHCAPAIKW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate?
The IUPAC name of [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate (CID 2833590) is [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate.
What is the SMILES notation for [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate?
The canonical SMILES for [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate is Cc1cccc(N2C(=O)CC(S/C(N)=N/c3ccccc3)C2=O)c1.
What is the InChIKey of [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate?
The InChIKey is ZEJNZKHCAPAIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2S/c1-12-6-5-9-14(10-12)21-16(22)11-15(17(21)23)24-18(19)20-13-7-3-2-4-8-13/h2-10,15H,11H2,1H3,(H2,19,20).
What are the key properties of [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate?
[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate has a molecular weight of 339.42 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N'-phenylcarbamimidothioate is sourced from PubChem (CID 2833590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).