About propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate
propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate (PubChem CID 2833741) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate |
| PubChem CID | 2833741 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate |
| SMILES | Cc1cc(C)c(C#N)c(SCC(=O)OC(C)C)n1 |
| InChI | InChI=1S/C13H16N2O2S/c1-8(2)17-12(16)7-18-13-11(6-14)9(3)5-10(4)15-13/h5,8H,7H2,1-4H3 |
| InChIKey | AOHOTHWDAOLMCC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
The IUPAC name of propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate (CID 2833741) is propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate.
What is the SMILES notation for propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
The canonical SMILES for propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate is Cc1cc(C)c(C#N)c(SCC(=O)OC(C)C)n1.
What is the InChIKey of propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
The InChIKey is AOHOTHWDAOLMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-8(2)17-12(16)7-18-13-11(6-14)9(3)5-10(4)15-13/h5,8H,7H2,1-4H3.
What are the key properties of propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate?
propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate has a molecular weight of 264.35 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]acetate is sourced from PubChem (CID 2833741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).