C33H30ClNO2 — CID 2833891
2-(4-butoxyphenyl)-5-(4-chlorophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one (PubChem CID 2833891) has the molecular formula C33H30ClNO2 and a molecular weight of 508.06 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-(4-chlorophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one.
| Compound Name | 2-(4-butoxyphenyl)-5-(4-chlorophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 2833891 |
| Molecular Formula | C33H30ClNO2 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-(4-chlorophenyl)-2,3,5,6-tetrahydro-1H-benzo[a]phenanthridin-4-one |
| SMILES | CCCCOc1ccc(C2CC(=O)C3=C(C2)c2c(ccc4ccccc24)NC3c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H30ClNO2/c1-2-3-18-37-26-15-10-21(11-16-26)24-19-28-31-27-7-5-4-6-22(27)12-17-29(31)35-33(32(28)30(36)20-24)23-8-13-25(34)14-9-23/h4-17,24,33,35H,2-3,18-20H2,1H3 |
| InChIKey | NOLBOUUVEQETBV-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|