About (4-ethylphenyl) N-phenylcarbamate
(4-ethylphenyl) N-phenylcarbamate (PubChem CID 2834241) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is (4-ethylphenyl) N-phenylcarbamate.
Molecular Properties
| Compound Name | (4-ethylphenyl) N-phenylcarbamate |
| PubChem CID | 2834241 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (4-ethylphenyl) N-phenylcarbamate |
| SMILES | CCc1ccc(OC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15NO2/c1-2-12-8-10-14(11-9-12)18-15(17)16-13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H,16,17) |
| InChIKey | SHCDPVWKSAFYIC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-ethylphenyl) N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl) N-phenylcarbamate?
The IUPAC name of (4-ethylphenyl) N-phenylcarbamate (CID 2834241) is (4-ethylphenyl) N-phenylcarbamate.
What is the SMILES notation for (4-ethylphenyl) N-phenylcarbamate?
The canonical SMILES for (4-ethylphenyl) N-phenylcarbamate is CCc1ccc(OC(=O)Nc2ccccc2)cc1.
What is the InChIKey of (4-ethylphenyl) N-phenylcarbamate?
The InChIKey is SHCDPVWKSAFYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-2-12-8-10-14(11-9-12)18-15(17)16-13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H,16,17).
What are the key properties of (4-ethylphenyl) N-phenylcarbamate?
(4-ethylphenyl) N-phenylcarbamate has a molecular weight of 241.29 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl) N-phenylcarbamate is sourced from PubChem (CID 2834241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).