C20H21NO4 — CID 2834390
ethyl 6-(1,3-dioxobenzo[de]isoquinolin-2-yl)hexanoate (PubChem CID 2834390) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is ethyl 6-(1,3-dioxobenzo[de]isoquinolin-2-yl)hexanoate.
| Compound Name | ethyl 6-(1,3-dioxobenzo[de]isoquinolin-2-yl)hexanoate |
|---|---|
| PubChem CID | 2834390 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | ethyl 6-(1,3-dioxobenzo[de]isoquinolin-2-yl)hexanoate |
| SMILES | CCOC(=O)CCCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C20H21NO4/c1-2-25-17(22)12-4-3-5-13-21-19(23)15-10-6-8-14-9-7-11-16(18(14)15)20(21)24/h6-11H,2-5,12-13H2,1H3 |
| InChIKey | LKTNERYONFVSNC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|