About 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate
2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate (PubChem CID 2834449) has the molecular formula C11H17ClN2O2
and a molecular weight of 244.72 g/mol. Its IUPAC name is 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate.
Molecular Properties
| Compound Name | 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate |
| PubChem CID | 2834449 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate |
| SMILES | CC1=CC(C)=[NH+]c2ccccc2N1.O.O.[Cl-] |
| InChI | InChI=1S/C11H12N2.ClH.2H2O/c1-8-7-9(2)13-11-6-4-3-5-10(11)12-8;;;/h3-7,12H,1-2H3;1H;2*1H2 |
| InChIKey | PAJWKOQVIOZVRO-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate?
The IUPAC name of 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate (CID 2834449) is 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate.
What is the SMILES notation for 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate?
The canonical SMILES for 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate is CC1=CC(C)=[NH+]c2ccccc2N1.O.O.[Cl-].
What is the InChIKey of 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate?
The InChIKey is PAJWKOQVIOZVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.ClH.2H2O/c1-8-7-9(2)13-11-6-4-3-5-10(11)12-8;;;/h3-7,12H,1-2H3;1H;2*1H2.
What are the key properties of 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate?
2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate has a molecular weight of 244.72 g/mol, XLogP of -3.46, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1H-1,5-benzodiazepin-5-ium;chloride;dihydrate is sourced from PubChem (CID 2834449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).