C24H28N2O2 — CID 2834639
methyl 2-[6-methyl-1-(1-phenylethylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate (PubChem CID 2834639) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 2-[6-methyl-1-(1-phenylethylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate.
| Compound Name | methyl 2-[6-methyl-1-(1-phenylethylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 2834639 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl 2-[6-methyl-1-(1-phenylethylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
| SMILES | COC(=O)Cn1c2c(c3cc(C)ccc31)CCCC2NC(C)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-16-12-13-22-20(14-16)19-10-7-11-21(24(19)26(22)15-23(27)28-3)25-17(2)18-8-5-4-6-9-18/h4-6,8-9,12-14,17,21,25H,7,10-11,15H2,1-3H3 |
| InChIKey | IPVYABONDHEMAS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|