About butyl 6-methylpiperidine-2-carboxylate;hydrochloride
butyl 6-methylpiperidine-2-carboxylate;hydrochloride (PubChem CID 2834679) has the molecular formula C11H22ClNO2
and a molecular weight of 235.75 g/mol. Its IUPAC name is butyl 6-methylpiperidine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | butyl 6-methylpiperidine-2-carboxylate;hydrochloride |
| PubChem CID | 2834679 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | butyl 6-methylpiperidine-2-carboxylate;hydrochloride |
| SMILES | CCCCOC(=O)C1CCCC(C)N1.Cl |
| InChI | InChI=1S/C11H21NO2.ClH/c1-3-4-8-14-11(13)10-7-5-6-9(2)12-10;/h9-10,12H,3-8H2,1-2H3;1H |
| InChIKey | KEXDWNYDFPGSCM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-methylpiperidine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-methylpiperidine-2-carboxylate;hydrochloride?
The IUPAC name of butyl 6-methylpiperidine-2-carboxylate;hydrochloride (CID 2834679) is butyl 6-methylpiperidine-2-carboxylate;hydrochloride.
What is the SMILES notation for butyl 6-methylpiperidine-2-carboxylate;hydrochloride?
The canonical SMILES for butyl 6-methylpiperidine-2-carboxylate;hydrochloride is CCCCOC(=O)C1CCCC(C)N1.Cl.
What is the InChIKey of butyl 6-methylpiperidine-2-carboxylate;hydrochloride?
The InChIKey is KEXDWNYDFPGSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2.ClH/c1-3-4-8-14-11(13)10-7-5-6-9(2)12-10;/h9-10,12H,3-8H2,1-2H3;1H.
What are the key properties of butyl 6-methylpiperidine-2-carboxylate;hydrochloride?
butyl 6-methylpiperidine-2-carboxylate;hydrochloride has a molecular weight of 235.75 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-methylpiperidine-2-carboxylate;hydrochloride is sourced from PubChem (CID 2834679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).