About 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one
2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one (PubChem CID 2834688) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one.
Molecular Properties
| Compound Name | 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one |
| PubChem CID | 2834688 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one |
| SMILES | CCCc1nc(N)nc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C13H19N3O/c1-4-5-8-11-9(16-12(14)15-8)6-13(2,3)7-10(11)17/h4-7H2,1-3H3,(H2,14,15,16) |
| InChIKey | MNXZQFMWFYKCDE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one?
The IUPAC name of 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one (CID 2834688) is 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one.
What is the SMILES notation for 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one?
The canonical SMILES for 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one is CCCc1nc(N)nc2c1C(=O)CC(C)(C)C2.
What is the InChIKey of 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one?
The InChIKey is MNXZQFMWFYKCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-4-5-8-11-9(16-12(14)15-8)6-13(2,3)7-10(11)17/h4-7H2,1-3H3,(H2,14,15,16).
What are the key properties of 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one?
2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one has a molecular weight of 233.31 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,7-dimethyl-4-propyl-6,8-dihydroquinazolin-5-one is sourced from PubChem (CID 2834688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).