About 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione
2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione (PubChem CID 2834772) has the molecular formula C20H22O3
and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione.
Molecular Properties
| Compound Name | 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione |
| PubChem CID | 2834772 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione |
| SMILES | CCCCc1oc2c(c(=O)c1C)C(=O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C20H22O3/c1-3-4-10-17-13(2)20(22)19-16(21)11-15(12-18(19)23-17)14-8-6-5-7-9-14/h5-9,15H,3-4,10-12H2,1-2H3 |
| InChIKey | LZZDOJDUUQQOKA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione?
The IUPAC name of 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione (CID 2834772) is 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione.
What is the SMILES notation for 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione?
The canonical SMILES for 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione is CCCCc1oc2c(c(=O)c1C)C(=O)CC(c1ccccc1)C2.
What is the InChIKey of 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione?
The InChIKey is LZZDOJDUUQQOKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O3/c1-3-4-10-17-13(2)20(22)19-16(21)11-15(12-18(19)23-17)14-8-6-5-7-9-14/h5-9,15H,3-4,10-12H2,1-2H3.
What are the key properties of 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione?
2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione has a molecular weight of 310.39 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione is sourced from PubChem (CID 2834772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).