C12H16N2O3 — CID 2834781
methyl 3,6,6-trimethyl-4-oxo-5,7-dihydro-2H-indazole-5-carboxylate (PubChem CID 2834781) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 3,6,6-trimethyl-4-oxo-5,7-dihydro-2H-indazole-5-carboxylate.
| Compound Name | methyl 3,6,6-trimethyl-4-oxo-5,7-dihydro-2H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 2834781 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | methyl 3,6,6-trimethyl-4-oxo-5,7-dihydro-2H-indazole-5-carboxylate |
| SMILES | COC(=O)C1C(=O)c2c(n[nH]c2C)CC1(C)C |
| InChI | InChI=1S/C12H16N2O3/c1-6-8-7(14-13-6)5-12(2,3)9(10(8)15)11(16)17-4/h9H,5H2,1-4H3,(H,13,14) |
| InChIKey | LPUVPADPTBIFJS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|