About 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride
4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride (PubChem CID 2835280) has the molecular formula C18H31ClN2O
and a molecular weight of 326.91 g/mol. Its IUPAC name is 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride.
Molecular Properties
| Compound Name | 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride |
| PubChem CID | 2835280 |
| Molecular Formula | C18H31ClN2O |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride |
| SMILES | CN(C)c1ccc(CNCCC2CCOC(C)(C)C2)cc1.Cl |
| InChI | InChI=1S/C18H30N2O.ClH/c1-18(2)13-15(10-12-21-18)9-11-19-14-16-5-7-17(8-6-16)20(3)4;/h5-8,15,19H,9-14H2,1-4H3;1H |
| InChIKey | AUEKGLLTZSJYKA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
The IUPAC name of 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride (CID 2835280) is 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride.
What is the SMILES notation for 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
The canonical SMILES for 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride is CN(C)c1ccc(CNCCC2CCOC(C)(C)C2)cc1.Cl.
What is the InChIKey of 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
The InChIKey is AUEKGLLTZSJYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O.ClH/c1-18(2)13-15(10-12-21-18)9-11-19-14-16-5-7-17(8-6-16)20(3)4;/h5-8,15,19H,9-14H2,1-4H3;1H.
What are the key properties of 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride?
4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride has a molecular weight of 326.91 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2,2-dimethyloxan-4-yl)ethylamino]methyl]-N,N-dimethylaniline;hydrochloride is sourced from PubChem (CID 2835280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).