About N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride
N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride (PubChem CID 2835432) has the molecular formula C22H28ClNO
and a molecular weight of 357.93 g/mol. Its IUPAC name is N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride |
| PubChem CID | 2835432 |
| Molecular Formula | C22H28ClNO |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride |
| SMILES | CCN(CC)CC#CCC(OC)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H27NO.ClH/c1-4-23(5-2)19-13-12-18-22(24-3,20-14-8-6-9-15-20)21-16-10-7-11-17-21;/h6-11,14-17H,4-5,18-19H2,1-3H3;1H |
| InChIKey | IBLMOEVPYKXRBA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride?
The IUPAC name of N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride (CID 2835432) is N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride.
What is the SMILES notation for N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride?
The canonical SMILES for N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride is CCN(CC)CC#CCC(OC)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride?
The InChIKey is IBLMOEVPYKXRBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO.ClH/c1-4-23(5-2)19-13-12-18-22(24-3,20-14-8-6-9-15-20)21-16-10-7-11-17-21;/h6-11,14-17H,4-5,18-19H2,1-3H3;1H.
What are the key properties of N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride?
N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride has a molecular weight of 357.93 g/mol, XLogP of 4.73, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5-methoxy-5,5-diphenylpent-2-yn-1-amine;hydrochloride is sourced from PubChem (CID 2835432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).