C15H21IN2O2 — CID 2835800
ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide (PubChem CID 2835800) has the molecular formula C15H21IN2O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide.
| Compound Name | ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide |
|---|---|
| PubChem CID | 2835800 |
| Molecular Formula | C15H21IN2O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CC)c(C)[n+]2CC.[I-] |
| InChI | InChI=1S/C15H21N2O2.HI/c1-5-16-11(4)17(6-2)14-10-12(8-9-13(14)16)15(18)19-7-3;/h8-10H,5-7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | GVGGQBWFQGAZFC-UHFFFAOYSA-M |
| XLogP | -0.54 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|