ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide

C15H21IN2O2 — CID 2835800

IUPACethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide
SMILESCCOC(=O)c1ccc2c(c1)n(CC)c(C)[n+]2CC.[I-]
InChIInChI=1S/C15H21N2O2.HI/c1-5-16-11(4)17(6-2)14-10-12(8-9-13(14)16)15(18)19-7-3;/h8-10H,5-7H2,1-4H3;1H/q+1;/p-1
InChIKeyGVGGQBWFQGAZFC-UHFFFAOYSA-M
MW388.25 g/mol
LogP-0.54
Rot. Bonds4

About ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide

ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide (PubChem CID 2835800) has the molecular formula C15H21IN2O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide.

Molecular Properties

Compound Nameethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide
PubChem CID2835800
Molecular FormulaC15H21IN2O2
Molecular Weight388.25 g/mol
Exact Mass388.06
IUPAC Nameethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide
SMILESCCOC(=O)c1ccc2c(c1)n(CC)c(C)[n+]2CC.[I-]
InChIInChI=1S/C15H21N2O2.HI/c1-5-16-11(4)17(6-2)14-10-12(8-9-13(14)16)15(18)19-7-3;/h8-10H,5-7H2,1-4H3;1H/q+1;/p-1
InChIKeyGVGGQBWFQGAZFC-UHFFFAOYSA-M
XLogP-0.54
TPSA35.11 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.25
LogP ≤ 5-0.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide?
The IUPAC name of ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide (CID 2835800) is ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide.
What is the SMILES notation for ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide?
The canonical SMILES for ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide is CCOC(=O)c1ccc2c(c1)n(CC)c(C)[n+]2CC.[I-].
What is the InChIKey of ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide?
The InChIKey is GVGGQBWFQGAZFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H21N2O2.HI/c1-5-16-11(4)17(6-2)14-10-12(8-9-13(14)16)15(18)19-7-3;/h8-10H,5-7H2,1-4H3;1H/q+1;/p-1.
What are the key properties of ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide?
ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide has a molecular weight of 388.25 g/mol, XLogP of -0.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxylate iodide is sourced from PubChem (CID 2835800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).