About ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate
ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 2835832) has the molecular formula C16H19NO5
and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate |
| PubChem CID | 2835832 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(O)C(C)(C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H19NO5/c1-4-22-15(21)12(18)16(2,3)9-17-13(19)10-7-5-6-8-11(10)14(17)20/h5-8,12,18H,4,9H2,1-3H3 |
| InChIKey | QISBAMKCBKJWFV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate?
The IUPAC name of ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate (CID 2835832) is ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate is CCOC(=O)C(O)C(C)(C)CN1C(=O)c2ccccc2C1=O.
What is the InChIKey of ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate?
The InChIKey is QISBAMKCBKJWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO5/c1-4-22-15(21)12(18)16(2,3)9-17-13(19)10-7-5-6-8-11(10)14(17)20/h5-8,12,18H,4,9H2,1-3H3.
What are the key properties of ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate?
ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate has a molecular weight of 305.33 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(1,3-dioxoisoindol-2-yl)-2-hydroxy-3,3-dimethylbutanoate is sourced from PubChem (CID 2835832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).