About spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol
spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol (PubChem CID 2835846) has the molecular formula C12H19NOS
and a molecular weight of 225.36 g/mol. Its IUPAC name is spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol.
Molecular Properties
| Compound Name | spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol |
| PubChem CID | 2835846 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol |
| SMILES | OC12CC3CC(C1)C1(NCCS1)C(C3)C2 |
| InChI | InChI=1S/C12H19NOS/c14-11-5-8-3-9(6-11)12(10(4-8)7-11)13-1-2-15-12/h8-10,13-14H,1-7H2 |
| InChIKey | CVRGPYJEPQFMMH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol?
The IUPAC name of spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol (CID 2835846) is spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol.
What is the SMILES notation for spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol?
The canonical SMILES for spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol is OC12CC3CC(C1)C1(NCCS1)C(C3)C2.
What is the InChIKey of spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol?
The InChIKey is CVRGPYJEPQFMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NOS/c14-11-5-8-3-9(6-11)12(10(4-8)7-11)13-1-2-15-12/h8-10,13-14H,1-7H2.
What are the key properties of spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol?
spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol has a molecular weight of 225.36 g/mol, XLogP of 1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-thiazolidine-2,4'-adamantane]-1'-ol is sourced from PubChem (CID 2835846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).