About 1-(1-adamantyl)-N,N-dimethylethanamine
1-(1-adamantyl)-N,N-dimethylethanamine (PubChem CID 2836008) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-(1-adamantyl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-N,N-dimethylethanamine |
| PubChem CID | 2836008 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-(1-adamantyl)-N,N-dimethylethanamine |
| SMILES | CC(N(C)C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H25N/c1-10(15(2)3)14-7-11-4-12(8-14)6-13(5-11)9-14/h10-13H,4-9H2,1-3H3 |
| InChIKey | OOQVJPLFOITUKD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-adamantyl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-N,N-dimethylethanamine?
The IUPAC name of 1-(1-adamantyl)-N,N-dimethylethanamine (CID 2836008) is 1-(1-adamantyl)-N,N-dimethylethanamine.
What is the SMILES notation for 1-(1-adamantyl)-N,N-dimethylethanamine?
The canonical SMILES for 1-(1-adamantyl)-N,N-dimethylethanamine is CC(N(C)C)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-N,N-dimethylethanamine?
The InChIKey is OOQVJPLFOITUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-10(15(2)3)14-7-11-4-12(8-14)6-13(5-11)9-14/h10-13H,4-9H2,1-3H3.
What are the key properties of 1-(1-adamantyl)-N,N-dimethylethanamine?
1-(1-adamantyl)-N,N-dimethylethanamine has a molecular weight of 207.36 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-N,N-dimethylethanamine is sourced from PubChem (CID 2836008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).