About 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride
4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride (PubChem CID 2836226) has the molecular formula C17H20ClN3
and a molecular weight of 301.82 g/mol. Its IUPAC name is 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride.
Molecular Properties
| Compound Name | 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride |
| PubChem CID | 2836226 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride |
| SMILES | CN(C)c1ccc(-c2n(C)c3ccccc3[n+]2C)cc1.[Cl-] |
| InChI | InChI=1S/C17H20N3.ClH/c1-18(2)14-11-9-13(10-12-14)17-19(3)15-7-5-6-8-16(15)20(17)4;/h5-12H,1-4H3;1H/q+1;/p-1 |
| InChIKey | AFIAECHUMSNDFA-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride?
The IUPAC name of 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride (CID 2836226) is 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride.
What is the SMILES notation for 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride?
The canonical SMILES for 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride is CN(C)c1ccc(-c2n(C)c3ccccc3[n+]2C)cc1.[Cl-].
What is the InChIKey of 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride?
The InChIKey is AFIAECHUMSNDFA-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H20N3.ClH/c1-18(2)14-11-9-13(10-12-14)17-19(3)15-7-5-6-8-16(15)20(17)4;/h5-12H,1-4H3;1H/q+1;/p-1.
What are the key properties of 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride?
4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride has a molecular weight of 301.82 g/mol, XLogP of -0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-dimethylaniline chloride is sourced from PubChem (CID 2836226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).