C22H20BrN3O2 — CID 2836228
1-(4-methoxyphenyl)-2-(1-methyl-2-phenylimidazo[4,5-c]pyridin-5-ium-5-yl)ethanone bromide (PubChem CID 2836228) has the molecular formula C22H20BrN3O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(1-methyl-2-phenylimidazo[4,5-c]pyridin-5-ium-5-yl)ethanone bromide.
| Compound Name | 1-(4-methoxyphenyl)-2-(1-methyl-2-phenylimidazo[4,5-c]pyridin-5-ium-5-yl)ethanone bromide |
|---|---|
| PubChem CID | 2836228 |
| Molecular Formula | C22H20BrN3O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(1-methyl-2-phenylimidazo[4,5-c]pyridin-5-ium-5-yl)ethanone bromide |
| SMILES | COc1ccc(C(=O)C[n+]2ccc3c(c2)nc(-c2ccccc2)n3C)cc1.[Br-] |
| InChI | InChI=1S/C22H20N3O2.BrH/c1-24-20-12-13-25(15-21(26)16-8-10-18(27-2)11-9-16)14-19(20)23-22(24)17-6-4-3-5-7-17;/h3-14H,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QIXKBGGQXIXJJR-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|